C22H32O6 — CID 177290568
4-O-(2-methoxyethyl) 1-O-(oxiran-2-ylmethyl) 2,5-ditert-butylbenzene-1,4-dicarboxylate (PubChem CID 177290568) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is 4-O-(2-methoxyethyl) 1-O-(oxiran-2-ylmethyl) 2,5-ditert-butylbenzene-1,4-dicarboxylate.
| Compound Name | 4-O-(2-methoxyethyl) 1-O-(oxiran-2-ylmethyl) 2,5-ditert-butylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 177290568 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 4-O-(2-methoxyethyl) 1-O-(oxiran-2-ylmethyl) 2,5-ditert-butylbenzene-1,4-dicarboxylate |
| SMILES | COCCOC(=O)c1cc(C(C)(C)C)c(C(=O)OCC2CO2)cc1C(C)(C)C |
| InChI | InChI=1S/C22H32O6/c1-21(2,3)17-11-16(20(24)28-13-14-12-27-14)18(22(4,5)6)10-15(17)19(23)26-9-8-25-7/h10-11,14H,8-9,12-13H2,1-7H3 |
| InChIKey | GPLAGQPQNGRNCI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|