C17H18O7 — CID 141222838
2-methyl-4-(oxiran-2-ylmethoxycarbonyl)-3-(2-prop-2-enoyloxyethyl)benzoic acid (PubChem CID 141222838) has the molecular formula C17H18O7 and a molecular weight of 334.32 g/mol. Its IUPAC name is 2-methyl-4-(oxiran-2-ylmethoxycarbonyl)-3-(2-prop-2-enoyloxyethyl)benzoic acid.
| Compound Name | 2-methyl-4-(oxiran-2-ylmethoxycarbonyl)-3-(2-prop-2-enoyloxyethyl)benzoic acid |
|---|---|
| PubChem CID | 141222838 |
| Molecular Formula | C17H18O7 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-methyl-4-(oxiran-2-ylmethoxycarbonyl)-3-(2-prop-2-enoyloxyethyl)benzoic acid |
| SMILES | C=CC(=O)OCCc1c(C(=O)OCC2CO2)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C17H18O7/c1-3-15(18)22-7-6-12-10(2)13(16(19)20)4-5-14(12)17(21)24-9-11-8-23-11/h3-5,11H,1,6-9H2,2H3,(H,19,20) |
| InChIKey | OICKJBKSYYQKHL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|