C17H18O8 — CID 142722568
4-(2-hydroxyethyl)-2-(oxiran-2-yloxycarbonyl)-3-(2-prop-2-enoyloxyethyl)benzoic acid (PubChem CID 142722568) has the molecular formula C17H18O8 and a molecular weight of 350.32 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-2-(oxiran-2-yloxycarbonyl)-3-(2-prop-2-enoyloxyethyl)benzoic acid.
| Compound Name | 4-(2-hydroxyethyl)-2-(oxiran-2-yloxycarbonyl)-3-(2-prop-2-enoyloxyethyl)benzoic acid |
|---|---|
| PubChem CID | 142722568 |
| Molecular Formula | C17H18O8 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 4-(2-hydroxyethyl)-2-(oxiran-2-yloxycarbonyl)-3-(2-prop-2-enoyloxyethyl)benzoic acid |
| SMILES | C=CC(=O)OCCc1c(CCO)ccc(C(=O)O)c1C(=O)OC1CO1 |
| InChI | InChI=1S/C17H18O8/c1-2-13(19)23-8-6-11-10(5-7-18)3-4-12(16(20)21)15(11)17(22)25-14-9-24-14/h2-4,14,18H,1,5-9H2,(H,20,21) |
| InChIKey | DRQFKNPVTQIZFO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|