C21H20O7 — CID 175357471
3-(2-hydroxyethyl)-4-phenyl-5-(2-prop-2-enoyloxyethyl)phthalic acid (PubChem CID 175357471) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-4-phenyl-5-(2-prop-2-enoyloxyethyl)phthalic acid.
| Compound Name | 3-(2-hydroxyethyl)-4-phenyl-5-(2-prop-2-enoyloxyethyl)phthalic acid |
|---|---|
| PubChem CID | 175357471 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 3-(2-hydroxyethyl)-4-phenyl-5-(2-prop-2-enoyloxyethyl)phthalic acid |
| SMILES | C=CC(=O)OCCc1cc(C(=O)O)c(C(=O)O)c(CCO)c1-c1ccccc1 |
| InChI | InChI=1S/C21H20O7/c1-2-17(23)28-11-9-14-12-16(20(24)25)19(21(26)27)15(8-10-22)18(14)13-6-4-3-5-7-13/h2-7,12,22H,1,8-11H2,(H,24,25)(H,26,27) |
| InChIKey | RNMNHJFSWRJUGX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|