C16H16O8 — CID 54047527
6-(4-prop-2-enoyloxybutyl)benzene-1,2,4-tricarboxylic acid (PubChem CID 54047527) has the molecular formula C16H16O8 and a molecular weight of 336.30 g/mol. Its IUPAC name is 6-(4-prop-2-enoyloxybutyl)benzene-1,2,4-tricarboxylic acid.
| Compound Name | 6-(4-prop-2-enoyloxybutyl)benzene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 54047527 |
| Molecular Formula | C16H16O8 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 6-(4-prop-2-enoyloxybutyl)benzene-1,2,4-tricarboxylic acid |
| SMILES | C=CC(=O)OCCCCc1cc(C(=O)O)cc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C16H16O8/c1-2-12(17)24-6-4-3-5-9-7-10(14(18)19)8-11(15(20)21)13(9)16(22)23/h2,7-8H,1,3-6H2,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | LQPLZBUAWLWNGM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|