C21H20O9 — CID 175711533
6-[3-(4-prop-2-enoyloxybutyl)-2H-pyran-2-yl]benzene-1,2,4-tricarboxylic acid (PubChem CID 175711533) has the molecular formula C21H20O9 and a molecular weight of 416.38 g/mol. Its IUPAC name is 6-[3-(4-prop-2-enoyloxybutyl)-2H-pyran-2-yl]benzene-1,2,4-tricarboxylic acid.
| Compound Name | 6-[3-(4-prop-2-enoyloxybutyl)-2H-pyran-2-yl]benzene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 175711533 |
| Molecular Formula | C21H20O9 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 6-[3-(4-prop-2-enoyloxybutyl)-2H-pyran-2-yl]benzene-1,2,4-tricarboxylic acid |
| SMILES | C=CC(=O)OCCCCC1=CC=COC1c1cc(C(=O)O)cc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C21H20O9/c1-2-16(22)29-8-4-3-6-12-7-5-9-30-18(12)14-10-13(19(23)24)11-15(20(25)26)17(14)21(27)28/h2,5,7,9-11,18H,1,3-4,6,8H2,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | QBZPXQFNKHZXCF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|