C26H26O12 — CID 19899365
6-[8-(2,3,5-tricarboxyphenyl)octyl]benzene-1,2,4-tricarboxylic acid (PubChem CID 19899365) has the molecular formula C26H26O12 and a molecular weight of 530.48 g/mol. Its IUPAC name is 6-[8-(2,3,5-tricarboxyphenyl)octyl]benzene-1,2,4-tricarboxylic acid.
| Compound Name | 6-[8-(2,3,5-tricarboxyphenyl)octyl]benzene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 19899365 |
| Molecular Formula | C26H26O12 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 6-[8-(2,3,5-tricarboxyphenyl)octyl]benzene-1,2,4-tricarboxylic acid |
| SMILES | O=C(O)c1cc(CCCCCCCCc2cc(C(=O)O)cc(C(=O)O)c2C(=O)O)c(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C26H26O12/c27-21(28)15-9-13(19(25(35)36)17(11-15)23(31)32)7-5-3-1-2-4-6-8-14-10-16(22(29)30)12-18(24(33)34)20(14)26(37)38/h9-12H,1-8H2,(H,27,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | JYEHRVLOVKVSOS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|