C20H30O6 — CID 101322087
4,5-bis(6-hydroxyhexyl)benzene-1,3-dicarboxylic acid (PubChem CID 101322087) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is 4,5-bis(6-hydroxyhexyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4,5-bis(6-hydroxyhexyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 101322087 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 4,5-bis(6-hydroxyhexyl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(CCCCCCO)c(CCCCCCO)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H30O6/c21-11-7-3-1-5-9-15-13-16(19(23)24)14-18(20(25)26)17(15)10-6-2-4-8-12-22/h13-14,21-22H,1-12H2,(H,23,24)(H,25,26) |
| InChIKey | GNSHMZOZGWPEAL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|