5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid

C13H16O5 — CID 67919849

IUPAC5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid
SMILESCc1c(CCCCO)cc(C(=O)O)cc1C(=O)O
InChIInChI=1S/C13H16O5/c1-8-9(4-2-3-5-14)6-10(12(15)16)7-11(8)13(17)18/h6-7,14H,2-5H2,1H3,(H,15,16)(H,17,18)
InChIKeyMRCUCKOTADRHDX-UHFFFAOYSA-N
MW252.27 g/mol
LogP1.71
Rot. Bonds6

About 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid

5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid (PubChem CID 67919849) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid
PubChem CID67919849
Molecular FormulaC13H16O5
Molecular Weight252.27 g/mol
Exact Mass252.10
IUPAC Name5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid
SMILESCc1c(CCCCO)cc(C(=O)O)cc1C(=O)O
InChIInChI=1S/C13H16O5/c1-8-9(4-2-3-5-14)6-10(12(15)16)7-11(8)13(17)18/h6-7,14H,2-5H2,1H3,(H,15,16)(H,17,18)
InChIKeyMRCUCKOTADRHDX-UHFFFAOYSA-N
XLogP1.71
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.27
LogP ≤ 51.71
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid (CID 67919849) is 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid is Cc1c(CCCCO)cc(C(=O)O)cc1C(=O)O.
What is the InChIKey of 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid?
The InChIKey is MRCUCKOTADRHDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O5/c1-8-9(4-2-3-5-14)6-10(12(15)16)7-11(8)13(17)18/h6-7,14H,2-5H2,1H3,(H,15,16)(H,17,18).
What are the key properties of 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid?
5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid has a molecular weight of 252.27 g/mol, XLogP of 1.71, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 67919849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).