C13H16O5 — CID 67919849
5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid (PubChem CID 67919849) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 67919849 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 5-(4-hydroxybutyl)-4-methylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(CCCCO)cc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C13H16O5/c1-8-9(4-2-3-5-14)6-10(12(15)16)7-11(8)13(17)18/h6-7,14H,2-5H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | MRCUCKOTADRHDX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|