C24H14O12 — CID 56633128
6-[4-(2,3,5-tricarboxyphenyl)phenyl]benzene-1,2,4-tricarboxylic acid (PubChem CID 56633128) has the molecular formula C24H14O12 and a molecular weight of 494.36 g/mol. Its IUPAC name is 6-[4-(2,3,5-tricarboxyphenyl)phenyl]benzene-1,2,4-tricarboxylic acid.
| Compound Name | 6-[4-(2,3,5-tricarboxyphenyl)phenyl]benzene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 56633128 |
| Molecular Formula | C24H14O12 |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 6-[4-(2,3,5-tricarboxyphenyl)phenyl]benzene-1,2,4-tricarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c(C(=O)O)c(-c2ccc(-c3cc(C(=O)O)cc(C(=O)O)c3C(=O)O)cc2)c1 |
| InChI | InChI=1S/C24H14O12/c25-19(26)11-5-13(17(23(33)34)15(7-11)21(29)30)9-1-2-10(4-3-9)14-6-12(20(27)28)8-16(22(31)32)18(14)24(35)36/h1-8H,(H,25,26)(H,27,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | MVZDZKZRNMLEGD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |