About 3-dodecylphthalic acid
3-dodecylphthalic acid (PubChem CID 19855185) has the molecular formula C20H30O4
and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-dodecylphthalic acid.
Molecular Properties
| Compound Name | 3-dodecylphthalic acid |
| PubChem CID | 19855185 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 3-dodecylphthalic acid |
| SMILES | CCCCCCCCCCCCc1cccc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-3-4-5-6-7-8-9-10-11-13-16-14-12-15-17(19(21)22)18(16)20(23)24/h12,14-15H,2-11,13H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | YQFAFGQFWCLSRT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-dodecylphthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dodecylphthalic acid?
The IUPAC name of 3-dodecylphthalic acid (CID 19855185) is 3-dodecylphthalic acid.
What is the SMILES notation for 3-dodecylphthalic acid?
The canonical SMILES for 3-dodecylphthalic acid is CCCCCCCCCCCCc1cccc(C(=O)O)c1C(=O)O.
What is the InChIKey of 3-dodecylphthalic acid?
The InChIKey is YQFAFGQFWCLSRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O4/c1-2-3-4-5-6-7-8-9-10-11-13-16-14-12-15-17(19(21)22)18(16)20(23)24/h12,14-15H,2-11,13H2,1H3,(H,21,22)(H,23,24).
What are the key properties of 3-dodecylphthalic acid?
3-dodecylphthalic acid has a molecular weight of 334.46 g/mol, XLogP of 5.55, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dodecylphthalic acid is sourced from PubChem (CID 19855185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).