C32H34O5 — CID 134200594
2-[5-(2-ethylphenyl)-2-[4-(2-hydroxyethyl)phenyl]-3-(2-prop-2-enoyloxyethyl)phenyl]ethyl prop-2-enoate (PubChem CID 134200594) has the molecular formula C32H34O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is 2-[5-(2-ethylphenyl)-2-[4-(2-hydroxyethyl)phenyl]-3-(2-prop-2-enoyloxyethyl)phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[5-(2-ethylphenyl)-2-[4-(2-hydroxyethyl)phenyl]-3-(2-prop-2-enoyloxyethyl)phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 134200594 |
| Molecular Formula | C32H34O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 2-[5-(2-ethylphenyl)-2-[4-(2-hydroxyethyl)phenyl]-3-(2-prop-2-enoyloxyethyl)phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1cc(-c2ccccc2CC)cc(CCOC(=O)C=C)c1-c1ccc(CCO)cc1 |
| InChI | InChI=1S/C32H34O5/c1-4-24-9-7-8-10-29(24)28-21-26(16-19-36-30(34)5-2)32(25-13-11-23(12-14-25)15-18-33)27(22-28)17-20-37-31(35)6-3/h5-14,21-22,33H,2-4,15-20H2,1H3 |
| InChIKey | IZNMUPMARBTJBE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|