C28H29FO3 — CID 134198088
2-[2-[2-[3-fluoro-4-[4-(3-hydroxypropyl)phenyl]phenyl]ethyl]phenyl]ethyl prop-2-enoate (PubChem CID 134198088) has the molecular formula C28H29FO3 and a molecular weight of 432.54 g/mol. Its IUPAC name is 2-[2-[2-[3-fluoro-4-[4-(3-hydroxypropyl)phenyl]phenyl]ethyl]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[2-[2-[3-fluoro-4-[4-(3-hydroxypropyl)phenyl]phenyl]ethyl]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 134198088 |
| Molecular Formula | C28H29FO3 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 2-[2-[2-[3-fluoro-4-[4-(3-hydroxypropyl)phenyl]phenyl]ethyl]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccccc1CCc1ccc(-c2ccc(CCCO)cc2)c(F)c1 |
| InChI | InChI=1S/C28H29FO3/c1-2-28(31)32-19-17-24-8-4-3-7-23(24)13-11-22-12-16-26(27(29)20-22)25-14-9-21(10-15-25)6-5-18-30/h2-4,7-10,12,14-16,20,30H,1,5-6,11,13,17-19H2 |
| InChIKey | GYSRYEWTFOXHHO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|