C30H34O3 — CID 134193671
[2-[4-(3-hydroxypropyl)phenyl]-5-(4-pentylphenyl)phenyl]methyl prop-2-enoate (PubChem CID 134193671) has the molecular formula C30H34O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is [2-[4-(3-hydroxypropyl)phenyl]-5-(4-pentylphenyl)phenyl]methyl prop-2-enoate.
| Compound Name | [2-[4-(3-hydroxypropyl)phenyl]-5-(4-pentylphenyl)phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 134193671 |
| Molecular Formula | C30H34O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | [2-[4-(3-hydroxypropyl)phenyl]-5-(4-pentylphenyl)phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1cc(-c2ccc(CCCCC)cc2)ccc1-c1ccc(CCCO)cc1 |
| InChI | InChI=1S/C30H34O3/c1-3-5-6-8-23-10-14-25(15-11-23)27-18-19-29(28(21-27)22-33-30(32)4-2)26-16-12-24(13-17-26)9-7-20-31/h4,10-19,21,31H,2-3,5-9,20,22H2,1H3 |
| InChIKey | VTQBYVOEUSDVFV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|