C33H44O3 — CID 134201084
[5-[2-(4-cyclohexylcyclohexyl)ethyl]-2-[4-(3-hydroxypropyl)phenyl]phenyl]methyl prop-2-enoate (PubChem CID 134201084) has the molecular formula C33H44O3 and a molecular weight of 488.71 g/mol. Its IUPAC name is [5-[2-(4-cyclohexylcyclohexyl)ethyl]-2-[4-(3-hydroxypropyl)phenyl]phenyl]methyl prop-2-enoate.
| Compound Name | [5-[2-(4-cyclohexylcyclohexyl)ethyl]-2-[4-(3-hydroxypropyl)phenyl]phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 134201084 |
| Molecular Formula | C33H44O3 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | [5-[2-(4-cyclohexylcyclohexyl)ethyl]-2-[4-(3-hydroxypropyl)phenyl]phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1cc(CCC2CCC(C3CCCCC3)CC2)ccc1-c1ccc(CCCO)cc1 |
| InChI | InChI=1S/C33H44O3/c1-2-33(35)36-24-31-23-27(16-21-32(31)30-19-14-25(15-20-30)7-6-22-34)11-10-26-12-17-29(18-13-26)28-8-4-3-5-9-28/h2,14-16,19-21,23,26,28-29,34H,1,3-13,17-18,22,24H2 |
| InChIKey | LLWUBMYKKZIJEM-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|