C23H32O3 — CID 134200800
[5-(4-cyclohexylcyclohexyl)-2-(hydroxymethyl)phenyl]methyl prop-2-enoate (PubChem CID 134200800) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is [5-(4-cyclohexylcyclohexyl)-2-(hydroxymethyl)phenyl]methyl prop-2-enoate.
| Compound Name | [5-(4-cyclohexylcyclohexyl)-2-(hydroxymethyl)phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 134200800 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | [5-(4-cyclohexylcyclohexyl)-2-(hydroxymethyl)phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1cc(C2CCC(C3CCCCC3)CC2)ccc1CO |
| InChI | InChI=1S/C23H32O3/c1-2-23(25)26-16-22-14-20(12-13-21(22)15-24)19-10-8-18(9-11-19)17-6-4-3-5-7-17/h2,12-14,17-19,24H,1,3-11,15-16H2 |
| InChIKey | MQUYIWYFLGJFBE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|