C29H42O3 — CID 134200663
2-[5-(6-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(hydroxymethyl)phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 134200663) has the molecular formula C29H42O3 and a molecular weight of 438.65 g/mol. Its IUPAC name is 2-[5-(6-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(hydroxymethyl)phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-(6-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(hydroxymethyl)phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134200663 |
| Molecular Formula | C29H42O3 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | 2-[5-(6-cyclohexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(hydroxymethyl)phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(C2CCC3CC(C4CCCCC4)CCC3C2)ccc1CO |
| InChI | InChI=1S/C29H42O3/c1-20(2)29(31)32-15-14-27-18-26(12-13-28(27)19-30)25-11-10-23-16-22(8-9-24(23)17-25)21-6-4-3-5-7-21/h12-13,18,21-25,30H,1,3-11,14-17,19H2,2H3 |
| InChIKey | RXLAKOOMKMMVOI-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|