C45H78O5Si — CID 140837913
3-[5-[4-(4-pentylcyclohexyl)cyclohexyl]-2-(3-tributoxysilylpropyl)phenyl]propyl 2-methylprop-2-enoate (PubChem CID 140837913) has the molecular formula C45H78O5Si and a molecular weight of 727.20 g/mol. Its IUPAC name is 3-[5-[4-(4-pentylcyclohexyl)cyclohexyl]-2-(3-tributoxysilylpropyl)phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-[4-(4-pentylcyclohexyl)cyclohexyl]-2-(3-tributoxysilylpropyl)phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140837913 |
| Molecular Formula | C45H78O5Si |
| Molecular Weight | 727.20 g/mol |
| Exact Mass | 726.56 |
| IUPAC Name | 3-[5-[4-(4-pentylcyclohexyl)cyclohexyl]-2-(3-tributoxysilylpropyl)phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(C2CCC(C3CCC(CCCCC)CC3)CC2)ccc1CCC[Si](OCCCC)(OCCCC)OCCCC |
| InChI | InChI=1S/C45H78O5Si/c1-7-11-15-18-38-21-23-40(24-22-38)41-25-27-42(28-26-41)44-30-29-39(43(36-44)19-16-31-47-45(46)37(5)6)20-17-35-51(48-32-12-8-2,49-33-13-9-3)50-34-14-10-4/h29-30,36,38,40-42H,5,7-28,31-35H2,1-4,6H3 |
| InChIKey | XBTPCKMHMTXILJ-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.20 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|