C27H34O3 — CID 145121993
2-[2-(3-hydroxypropyl)-5-[4-(4-methylcyclohexyl)phenyl]phenyl]ethyl prop-2-enoate (PubChem CID 145121993) has the molecular formula C27H34O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropyl)-5-[4-(4-methylcyclohexyl)phenyl]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[2-(3-hydroxypropyl)-5-[4-(4-methylcyclohexyl)phenyl]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 145121993 |
| Molecular Formula | C27H34O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 2-[2-(3-hydroxypropyl)-5-[4-(4-methylcyclohexyl)phenyl]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1cc(-c2ccc(C3CCC(C)CC3)cc2)ccc1CCCO |
| InChI | InChI=1S/C27H34O3/c1-3-27(29)30-18-16-26-19-25(15-14-21(26)5-4-17-28)24-12-10-23(11-13-24)22-8-6-20(2)7-9-22/h3,10-15,19-20,22,28H,1,4-9,16-18H2,2H3 |
| InChIKey | JLBJNLYGRQUUPQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|