C25H30O5 — CID 134199553
2-[2-(3-hydroxypropyl)-5-[4-(oxan-2-yl)phenyl]phenoxy]ethyl prop-2-enoate (PubChem CID 134199553) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropyl)-5-[4-(oxan-2-yl)phenyl]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-(3-hydroxypropyl)-5-[4-(oxan-2-yl)phenyl]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 134199553 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-[2-(3-hydroxypropyl)-5-[4-(oxan-2-yl)phenyl]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1cc(-c2ccc(C3CCCCO3)cc2)ccc1CCCO |
| InChI | InChI=1S/C25H30O5/c1-2-25(27)30-17-16-29-24-18-22(13-12-20(24)6-5-14-26)19-8-10-21(11-9-19)23-7-3-4-15-28-23/h2,8-13,18,23,26H,1,3-7,14-17H2 |
| InChIKey | OIHXEAQXECXGHR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|