C29H42O6 — CID 145217211
6-[6-[4-(6-prop-2-enoyloxyhexoxy)phenyl]oxan-3-yl]hexyl prop-2-enoate (PubChem CID 145217211) has the molecular formula C29H42O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is 6-[6-[4-(6-prop-2-enoyloxyhexoxy)phenyl]oxan-3-yl]hexyl prop-2-enoate.
| Compound Name | 6-[6-[4-(6-prop-2-enoyloxyhexoxy)phenyl]oxan-3-yl]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 145217211 |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 6-[6-[4-(6-prop-2-enoyloxyhexoxy)phenyl]oxan-3-yl]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C2CCC(CCCCCCOC(=O)C=C)CO2)cc1 |
| InChI | InChI=1S/C29H42O6/c1-3-28(30)33-21-11-6-5-9-13-24-14-19-27(35-23-24)25-15-17-26(18-16-25)32-20-10-7-8-12-22-34-29(31)4-2/h3-4,15-18,24,27H,1-2,5-14,19-23H2 |
| InChIKey | AQFYOQCJFAZDNF-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|