C26H36O7 — CID 20607645
5-[2-[4-(5-prop-2-enoyloxypentoxy)phenyl]-1,3-dioxan-5-yl]pentyl prop-2-enoate (PubChem CID 20607645) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is 5-[2-[4-(5-prop-2-enoyloxypentoxy)phenyl]-1,3-dioxan-5-yl]pentyl prop-2-enoate.
| Compound Name | 5-[2-[4-(5-prop-2-enoyloxypentoxy)phenyl]-1,3-dioxan-5-yl]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 20607645 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 5-[2-[4-(5-prop-2-enoyloxypentoxy)phenyl]-1,3-dioxan-5-yl]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCOc1ccc(C2OCC(CCCCCOC(=O)C=C)CO2)cc1 |
| InChI | InChI=1S/C26H36O7/c1-3-24(27)30-17-8-5-7-11-21-19-32-26(33-20-21)22-12-14-23(15-13-22)29-16-9-6-10-18-31-25(28)4-2/h3-4,12-15,21,26H,1-2,5-11,16-20H2 |
| InChIKey | QWJHJYPXGFMUKD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|