C34H44O9 — CID 54496998
dibutyl (4R,5R)-2-[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 54496998) has the molecular formula C34H44O9 and a molecular weight of 596.72 g/mol. Its IUPAC name is dibutyl (4R,5R)-2-[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | dibutyl (4R,5R)-2-[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 54496998 |
| Molecular Formula | C34H44O9 |
| Molecular Weight | 596.72 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | dibutyl (4R,5R)-2-[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(-c2ccc(C3O[C@@H](C(=O)OCCCC)[C@H](C(=O)OCCCC)O3)cc2)cc1 |
| InChI | InChI=1S/C34H44O9/c1-4-7-21-40-32(36)30-31(33(37)41-22-8-5-2)43-34(42-30)27-15-13-25(14-16-27)26-17-19-28(20-18-26)38-23-11-9-10-12-24-39-29(35)6-3/h6,13-20,30-31,34H,3-5,7-12,21-24H2,1-2H3/t30-,31-/m1/s1 |
| InChIKey | XZUQWYYRJJREPG-FIRIVFDPSA-N |
| XLogP | 6.49 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.72 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|