C37H48O5 — CID 135139312
2-[5-[2-ethyl-4-[2-(4-pentylphenyl)ethyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]phenyl]ethyl prop-2-enoate (PubChem CID 135139312) has the molecular formula C37H48O5 and a molecular weight of 572.79 g/mol. Its IUPAC name is 2-[5-[2-ethyl-4-[2-(4-pentylphenyl)ethyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[5-[2-ethyl-4-[2-(4-pentylphenyl)ethyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 135139312 |
| Molecular Formula | C37H48O5 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | 2-[5-[2-ethyl-4-[2-(4-pentylphenyl)ethyl]phenyl]-2-[4-hydroxy-3-(hydroxymethyl)butoxy]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1cc(-c2ccc(CCc3ccc(CCCCC)cc3)cc2CC)ccc1OCCC(CO)CO |
| InChI | InChI=1S/C37H48O5/c1-4-7-8-9-28-10-12-29(13-11-28)14-15-30-16-18-35(32(5-2)24-30)33-17-19-36(41-22-20-31(26-38)27-39)34(25-33)21-23-42-37(40)6-3/h6,10-13,16-19,24-25,31,38-39H,3-5,7-9,14-15,20-23,26-27H2,1-2H3 |
| InChIKey | OIKWBKWMUKZQTP-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|