C23H24O9 — CID 67704213
1-hydroxy-4-(2-prop-2-enoyloxyethyl)naphthalene-2,3-dicarboxylic acid;propyl prop-2-enoate (PubChem CID 67704213) has the molecular formula C23H24O9 and a molecular weight of 444.44 g/mol. Its IUPAC name is 1-hydroxy-4-(2-prop-2-enoyloxyethyl)naphthalene-2,3-dicarboxylic acid;propyl prop-2-enoate.
| Compound Name | 1-hydroxy-4-(2-prop-2-enoyloxyethyl)naphthalene-2,3-dicarboxylic acid;propyl prop-2-enoate |
|---|---|
| PubChem CID | 67704213 |
| Molecular Formula | C23H24O9 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 1-hydroxy-4-(2-prop-2-enoyloxyethyl)naphthalene-2,3-dicarboxylic acid;propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC.C=CC(=O)OCCc1c(C(=O)O)c(C(=O)O)c(O)c2ccccc12 |
| InChI | InChI=1S/C17H14O7.C6H10O2/c1-2-12(18)24-8-7-10-9-5-3-4-6-11(9)15(19)14(17(22)23)13(10)16(20)21;1-3-5-8-6(7)4-2/h2-6,19H,1,7-8H2,(H,20,21)(H,22,23);4H,2-3,5H2,1H3 |
| InChIKey | VVXKWPWAOKIVOT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|