C60H50O11 — CID 138558587
2-[3-phenoxy-4-[2-phenoxy-9,10-bis(2-prop-2-enoyloxyethyl)anthracen-1-yl]oxy-10-(2-prop-2-enoyloxyethyl)anthracen-9-yl]ethyl prop-2-enoate (PubChem CID 138558587) has the molecular formula C60H50O11 and a molecular weight of 947.05 g/mol. Its IUPAC name is 2-[3-phenoxy-4-[2-phenoxy-9,10-bis(2-prop-2-enoyloxyethyl)anthracen-1-yl]oxy-10-(2-prop-2-enoyloxyethyl)anthracen-9-yl]ethyl prop-2-enoate.
| Compound Name | 2-[3-phenoxy-4-[2-phenoxy-9,10-bis(2-prop-2-enoyloxyethyl)anthracen-1-yl]oxy-10-(2-prop-2-enoyloxyethyl)anthracen-9-yl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 138558587 |
| Molecular Formula | C60H50O11 |
| Molecular Weight | 947.05 g/mol |
| Exact Mass | 946.34 |
| IUPAC Name | 2-[3-phenoxy-4-[2-phenoxy-9,10-bis(2-prop-2-enoyloxyethyl)anthracen-1-yl]oxy-10-(2-prop-2-enoyloxyethyl)anthracen-9-yl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1c2ccccc2c(CCOC(=O)C=C)c2c(Oc3c(Oc4ccccc4)ccc4c(CCOC(=O)C=C)c5ccccc5c(CCOC(=O)C=C)c34)c(Oc3ccccc3)ccc12 |
| InChI | InChI=1S/C60H50O11/c1-5-53(61)65-35-31-45-41-23-15-17-25-43(41)49(33-37-67-55(63)7-3)57-47(45)27-29-51(69-39-19-11-9-12-20-39)59(57)71-60-52(70-40-21-13-10-14-22-40)30-28-48-46(32-36-66-54(62)6-2)42-24-16-18-26-44(42)50(58(48)60)34-38-68-56(64)8-4/h5-30H,1-4,31-38H2 |
| InChIKey | YJAUQJBGUKEUAC-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.05 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|