C12H11NO8 — CID 174622074
5-carbamoyl-3-(2-hydroxyethyl)benzene-1,2,4-tricarboxylic acid (PubChem CID 174622074) has the molecular formula C12H11NO8 and a molecular weight of 297.22 g/mol. Its IUPAC name is 5-carbamoyl-3-(2-hydroxyethyl)benzene-1,2,4-tricarboxylic acid.
| Compound Name | 5-carbamoyl-3-(2-hydroxyethyl)benzene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 174622074 |
| Molecular Formula | C12H11NO8 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 5-carbamoyl-3-(2-hydroxyethyl)benzene-1,2,4-tricarboxylic acid |
| SMILES | NC(=O)c1cc(C(=O)O)c(C(=O)O)c(CCO)c1C(=O)O |
| InChI | InChI=1S/C12H11NO8/c13-9(15)5-3-6(10(16)17)8(12(20)21)4(1-2-14)7(5)11(18)19/h3,14H,1-2H2,(H2,13,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | MHALJKSUAYBYKJ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |