2,5-bis(2-hydroxyethyl)terephthalic acid

C12H14O6 — CID 175518382

IUPAC2,5-bis(2-hydroxyethyl)terephthalic acid
SMILESO=C(O)c1cc(CCO)c(C(=O)O)cc1CCO
InChIInChI=1S/C12H14O6/c13-3-1-7-5-10(12(17)18)8(2-4-14)6-9(7)11(15)16/h5-6,13-14H,1-4H2,(H,15,16)(H,17,18)
InChIKeyCQKGLLKABUZSBT-UHFFFAOYSA-N
MW254.24 g/mol
LogP0.15
Rot. Bonds6

About 2,5-bis(2-hydroxyethyl)terephthalic acid

2,5-bis(2-hydroxyethyl)terephthalic acid (PubChem CID 175518382) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2,5-bis(2-hydroxyethyl)terephthalic acid.

Molecular Properties

Compound Name2,5-bis(2-hydroxyethyl)terephthalic acid
PubChem CID175518382
Molecular FormulaC12H14O6
Molecular Weight254.24 g/mol
Exact Mass254.08
IUPAC Name2,5-bis(2-hydroxyethyl)terephthalic acid
SMILESO=C(O)c1cc(CCO)c(C(=O)O)cc1CCO
InChIInChI=1S/C12H14O6/c13-3-1-7-5-10(12(17)18)8(2-4-14)6-9(7)11(15)16/h5-6,13-14H,1-4H2,(H,15,16)(H,17,18)
InChIKeyCQKGLLKABUZSBT-UHFFFAOYSA-N
XLogP0.15
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.24
LogP ≤ 50.15
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2,5-bis(2-hydroxyethyl)terephthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-bis(2-hydroxyethyl)terephthalic acid?
The IUPAC name of 2,5-bis(2-hydroxyethyl)terephthalic acid (CID 175518382) is 2,5-bis(2-hydroxyethyl)terephthalic acid.
What is the SMILES notation for 2,5-bis(2-hydroxyethyl)terephthalic acid?
The canonical SMILES for 2,5-bis(2-hydroxyethyl)terephthalic acid is O=C(O)c1cc(CCO)c(C(=O)O)cc1CCO.
What is the InChIKey of 2,5-bis(2-hydroxyethyl)terephthalic acid?
The InChIKey is CQKGLLKABUZSBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O6/c13-3-1-7-5-10(12(17)18)8(2-4-14)6-9(7)11(15)16/h5-6,13-14H,1-4H2,(H,15,16)(H,17,18).
What are the key properties of 2,5-bis(2-hydroxyethyl)terephthalic acid?
2,5-bis(2-hydroxyethyl)terephthalic acid has a molecular weight of 254.24 g/mol, XLogP of 0.15, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(2-hydroxyethyl)terephthalic acid is sourced from PubChem (CID 175518382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).