C12H14O6 — CID 175518382
2,5-bis(2-hydroxyethyl)terephthalic acid (PubChem CID 175518382) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2,5-bis(2-hydroxyethyl)terephthalic acid.
| Compound Name | 2,5-bis(2-hydroxyethyl)terephthalic acid |
|---|---|
| PubChem CID | 175518382 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2,5-bis(2-hydroxyethyl)terephthalic acid |
| SMILES | O=C(O)c1cc(CCO)c(C(=O)O)cc1CCO |
| InChI | InChI=1S/C12H14O6/c13-3-1-7-5-10(12(17)18)8(2-4-14)6-9(7)11(15)16/h5-6,13-14H,1-4H2,(H,15,16)(H,17,18) |
| InChIKey | CQKGLLKABUZSBT-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |