C18H26O10 — CID 101322056
4,6-bis[2-(2-hydroxyethoxymethoxy)ethyl]benzene-1,3-dicarboxylic acid (PubChem CID 101322056) has the molecular formula C18H26O10 and a molecular weight of 402.40 g/mol. Its IUPAC name is 4,6-bis[2-(2-hydroxyethoxymethoxy)ethyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4,6-bis[2-(2-hydroxyethoxymethoxy)ethyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 101322056 |
| Molecular Formula | C18H26O10 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 4,6-bis[2-(2-hydroxyethoxymethoxy)ethyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c(CCOCOCCO)cc1CCOCOCCO |
| InChI | InChI=1S/C18H26O10/c19-3-7-27-11-25-5-1-13-9-14(2-6-26-12-28-8-4-20)16(18(23)24)10-15(13)17(21)22/h9-10,19-20H,1-8,11-12H2,(H,21,22)(H,23,24) |
| InChIKey | YYAZBFBSBOCAEI-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|