About 2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol
2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol (PubChem CID 174967065) has the molecular formula C20H20O10
and a molecular weight of 420.37 g/mol. Its IUPAC name is 2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol.
Molecular Properties
| Compound Name | 2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol |
| PubChem CID | 174967065 |
| Molecular Formula | C20H20O10 |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol |
| SMILES | O=C(O)c1ccc(C(=O)OC(=O)c2ccccc2C(=O)O)cc1.OCCOCCO |
| InChI | InChI=1S/C16H10O7.C4H10O3/c17-13(18)9-5-7-10(8-6-9)15(21)23-16(22)12-4-2-1-3-11(12)14(19)20;5-1-3-7-4-2-6/h1-8H,(H,17,18)(H,19,20);5-6H,1-4H2 |
| InChIKey | JNWAGSNYRWLPIU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol?
The IUPAC name of 2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol (CID 174967065) is 2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol.
What is the SMILES notation for 2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol?
The canonical SMILES for 2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol is O=C(O)c1ccc(C(=O)OC(=O)c2ccccc2C(=O)O)cc1.OCCOCCO.
What is the InChIKey of 2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol?
The InChIKey is JNWAGSNYRWLPIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O7.C4H10O3/c17-13(18)9-5-7-10(8-6-9)15(21)23-16(22)12-4-2-1-3-11(12)14(19)20;5-1-3-7-4-2-6/h1-8H,(H,17,18)(H,19,20);5-6H,1-4H2.
What are the key properties of 2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol?
2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol has a molecular weight of 420.37 g/mol, XLogP of 1.07, 8 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-carboxybenzoyl)oxycarbonylbenzoic acid;2-(2-hydroxyethoxy)ethanol is sourced from PubChem (CID 174967065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).