C18H24O11 — CID 175831350
2-(2-hydroxyethoxy)ethanol;bis(prop-2-enoic acid);terephthalic acid (PubChem CID 175831350) has the molecular formula C18H24O11 and a molecular weight of 416.38 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;bis(prop-2-enoic acid);terephthalic acid.
| Compound Name | 2-(2-hydroxyethoxy)ethanol;bis(prop-2-enoic acid);terephthalic acid |
|---|---|
| PubChem CID | 175831350 |
| Molecular Formula | C18H24O11 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;bis(prop-2-enoic acid);terephthalic acid |
| SMILES | C=CC(=O)O.C=CC(=O)O.O=C(O)c1ccc(C(=O)O)cc1.OCCOCCO |
| InChI | InChI=1S/C8H6O4.C4H10O3.2C3H4O2/c9-7(10)5-1-2-6(4-3-5)8(11)12;5-1-3-7-4-2-6;2*1-2-3(4)5/h1-4H,(H,9,10)(H,11,12);5-6H,1-4H2;2*2H,1H2,(H,4,5) |
| InChIKey | QURDINCXSYTJSA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 198.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|