C14H18O8 — CID 157389848
propane-1,2-diol;prop-2-enoic acid;terephthalic acid (PubChem CID 157389848) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is propane-1,2-diol;prop-2-enoic acid;terephthalic acid.
| Compound Name | propane-1,2-diol;prop-2-enoic acid;terephthalic acid |
|---|---|
| PubChem CID | 157389848 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | propane-1,2-diol;prop-2-enoic acid;terephthalic acid |
| SMILES | C=CC(=O)O.CC(O)CO.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H6O4.C3H8O2.C3H4O2/c9-7(10)5-1-2-6(4-3-5)8(11)12;1-3(5)2-4;1-2-3(4)5/h1-4H,(H,9,10)(H,11,12);3-5H,2H2,1H3;2H,1H2,(H,4,5) |
| InChIKey | BLWIZRUNCGLNTD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|