About ethene;prop-1-ene;terephthalic acid
ethene;prop-1-ene;terephthalic acid (PubChem CID 70629697) has the molecular formula C13H16O4
and a molecular weight of 236.27 g/mol. Its IUPAC name is ethene;prop-1-ene;terephthalic acid.
Molecular Properties
| Compound Name | ethene;prop-1-ene;terephthalic acid |
| PubChem CID | 70629697 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | ethene;prop-1-ene;terephthalic acid |
| SMILES | C=C.C=CC.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H6O4.C3H6.C2H4/c9-7(10)5-1-2-6(4-3-5)8(11)12;1-3-2;1-2/h1-4H,(H,9,10)(H,11,12);3H,1H2,2H3;1-2H2 |
| InChIKey | OEFWADSGJIQDDI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;prop-1-ene;terephthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;prop-1-ene;terephthalic acid?
The IUPAC name of ethene;prop-1-ene;terephthalic acid (CID 70629697) is ethene;prop-1-ene;terephthalic acid.
What is the SMILES notation for ethene;prop-1-ene;terephthalic acid?
The canonical SMILES for ethene;prop-1-ene;terephthalic acid is C=C.C=CC.O=C(O)c1ccc(C(=O)O)cc1.
What is the InChIKey of ethene;prop-1-ene;terephthalic acid?
The InChIKey is OEFWADSGJIQDDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.C3H6.C2H4/c9-7(10)5-1-2-6(4-3-5)8(11)12;1-3-2;1-2/h1-4H,(H,9,10)(H,11,12);3H,1H2,2H3;1-2H2.
What are the key properties of ethene;prop-1-ene;terephthalic acid?
ethene;prop-1-ene;terephthalic acid has a molecular weight of 236.27 g/mol, XLogP of 3.08, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;prop-1-ene;terephthalic acid is sourced from PubChem (CID 70629697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).