C6H13NO3 — CID 135223311
propane-1,2-diol;prop-2-enamide (PubChem CID 135223311) has the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. Its IUPAC name is propane-1,2-diol;prop-2-enamide.
| Compound Name | propane-1,2-diol;prop-2-enamide |
|---|---|
| PubChem CID | 135223311 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | propane-1,2-diol;prop-2-enamide |
| SMILES | C=CC(N)=O.CC(O)CO |
| InChI | InChI=1S/C3H5NO.C3H8O2/c1-2-3(4)5;1-3(5)2-4/h2H,1H2,(H2,4,5);3-5H,2H2,1H3 |
| InChIKey | ARNYGFKDEUFDHV-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|