About 3-methylbutanoic acid;prop-2-enamide
3-methylbutanoic acid;prop-2-enamide (PubChem CID 146306740) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 3-methylbutanoic acid;prop-2-enamide.
Molecular Properties
| Compound Name | 3-methylbutanoic acid;prop-2-enamide |
| PubChem CID | 146306740 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 3-methylbutanoic acid;prop-2-enamide |
| SMILES | C=CC(N)=O.CC(C)CC(=O)O |
| InChI | InChI=1S/C5H10O2.C3H5NO/c1-4(2)3-5(6)7;1-2-3(4)5/h4H,3H2,1-2H3,(H,6,7);2H,1H2,(H2,4,5) |
| InChIKey | ZWHIOOFPWOPCCA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutanoic acid;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutanoic acid;prop-2-enamide?
The IUPAC name of 3-methylbutanoic acid;prop-2-enamide (CID 146306740) is 3-methylbutanoic acid;prop-2-enamide.
What is the SMILES notation for 3-methylbutanoic acid;prop-2-enamide?
The canonical SMILES for 3-methylbutanoic acid;prop-2-enamide is C=CC(N)=O.CC(C)CC(=O)O.
What is the InChIKey of 3-methylbutanoic acid;prop-2-enamide?
The InChIKey is ZWHIOOFPWOPCCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C3H5NO/c1-4(2)3-5(6)7;1-2-3(4)5/h4H,3H2,1-2H3,(H,6,7);2H,1H2,(H2,4,5).
What are the key properties of 3-methylbutanoic acid;prop-2-enamide?
3-methylbutanoic acid;prop-2-enamide has a molecular weight of 173.21 g/mol, XLogP of 0.77, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutanoic acid;prop-2-enamide is sourced from PubChem (CID 146306740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).