About hydrazine;3-methylbutanoic acid
hydrazine;3-methylbutanoic acid (PubChem CID 175217584) has the molecular formula C5H14N2O2
and a molecular weight of 134.18 g/mol. Its IUPAC name is hydrazine;3-methylbutanoic acid.
Molecular Properties
| Compound Name | hydrazine;3-methylbutanoic acid |
| PubChem CID | 175217584 |
| Molecular Formula | C5H14N2O2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | hydrazine;3-methylbutanoic acid |
| SMILES | CC(C)CC(=O)O.NN |
| InChI | InChI=1S/C5H10O2.H4N2/c1-4(2)3-5(6)7;1-2/h4H,3H2,1-2H3,(H,6,7);1-2H2 |
| InChIKey | DNTAJWCISACKAR-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;3-methylbutanoic acid?
The IUPAC name of hydrazine;3-methylbutanoic acid (CID 175217584) is hydrazine;3-methylbutanoic acid.
What is the SMILES notation for hydrazine;3-methylbutanoic acid?
The canonical SMILES for hydrazine;3-methylbutanoic acid is CC(C)CC(=O)O.NN.
What is the InChIKey of hydrazine;3-methylbutanoic acid?
The InChIKey is DNTAJWCISACKAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.H4N2/c1-4(2)3-5(6)7;1-2/h4H,3H2,1-2H3,(H,6,7);1-2H2.
What are the key properties of hydrazine;3-methylbutanoic acid?
hydrazine;3-methylbutanoic acid has a molecular weight of 134.18 g/mol, XLogP of -0.06, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;3-methylbutanoic acid is sourced from PubChem (CID 175217584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).