hydrazine;3-methylbutanoic acid

C5H14N2O2 — CID 175217584

IUPAChydrazine;3-methylbutanoic acid
SMILESCC(C)CC(=O)O.NN
InChIInChI=1S/C5H10O2.H4N2/c1-4(2)3-5(6)7;1-2/h4H,3H2,1-2H3,(H,6,7);1-2H2
InChIKeyDNTAJWCISACKAR-UHFFFAOYSA-N
MW134.18 g/mol
LogP-0.06
Rot. Bonds2

About hydrazine;3-methylbutanoic acid

hydrazine;3-methylbutanoic acid (PubChem CID 175217584) has the molecular formula C5H14N2O2 and a molecular weight of 134.18 g/mol. Its IUPAC name is hydrazine;3-methylbutanoic acid.

Molecular Properties

Compound Namehydrazine;3-methylbutanoic acid
PubChem CID175217584
Molecular FormulaC5H14N2O2
Molecular Weight134.18 g/mol
Exact Mass134.11
IUPAC Namehydrazine;3-methylbutanoic acid
SMILESCC(C)CC(=O)O.NN
InChIInChI=1S/C5H10O2.H4N2/c1-4(2)3-5(6)7;1-2/h4H,3H2,1-2H3,(H,6,7);1-2H2
InChIKeyDNTAJWCISACKAR-UHFFFAOYSA-N
XLogP-0.06
TPSA89.34 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500134.18
LogP ≤ 5-0.06
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze hydrazine;3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrazine;3-methylbutanoic acid?
The IUPAC name of hydrazine;3-methylbutanoic acid (CID 175217584) is hydrazine;3-methylbutanoic acid.
What is the SMILES notation for hydrazine;3-methylbutanoic acid?
The canonical SMILES for hydrazine;3-methylbutanoic acid is CC(C)CC(=O)O.NN.
What is the InChIKey of hydrazine;3-methylbutanoic acid?
The InChIKey is DNTAJWCISACKAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.H4N2/c1-4(2)3-5(6)7;1-2/h4H,3H2,1-2H3,(H,6,7);1-2H2.
What are the key properties of hydrazine;3-methylbutanoic acid?
hydrazine;3-methylbutanoic acid has a molecular weight of 134.18 g/mol, XLogP of -0.06, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;3-methylbutanoic acid is sourced from PubChem (CID 175217584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).