About (3S)-3-aminobutanoic acid;hydrochloride
(3S)-3-aminobutanoic acid;hydrochloride (PubChem CID 2761505) has the molecular formula C4H10ClNO2
and a molecular weight of 139.58 g/mol. Its IUPAC name is (3S)-3-aminobutanoic acid;hydrochloride.
Molecular Properties
| Compound Name | (3S)-3-aminobutanoic acid;hydrochloride |
| PubChem CID | 2761505 |
| Molecular Formula | C4H10ClNO2 |
| Molecular Weight | 139.58 g/mol |
| Exact Mass | 139.04 |
| IUPAC Name | (3S)-3-aminobutanoic acid;hydrochloride |
| SMILES | C[C@H](N)CC(=O)O.Cl |
| InChI | InChI=1S/C4H9NO2.ClH/c1-3(5)2-4(6)7;/h3H,2,5H2,1H3,(H,6,7);1H/t3-;/m0./s1 |
| InChIKey | UHYVVUABAWKTJJ-DFWYDOINSA-N |
| XLogP | 0.23 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.58 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-aminobutanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-aminobutanoic acid;hydrochloride?
The IUPAC name of (3S)-3-aminobutanoic acid;hydrochloride (CID 2761505) is (3S)-3-aminobutanoic acid;hydrochloride.
What is the SMILES notation for (3S)-3-aminobutanoic acid;hydrochloride?
The canonical SMILES for (3S)-3-aminobutanoic acid;hydrochloride is C[C@H](N)CC(=O)O.Cl.
What is the InChIKey of (3S)-3-aminobutanoic acid;hydrochloride?
The InChIKey is UHYVVUABAWKTJJ-DFWYDOINSA-N. The full InChI is InChI=1S/C4H9NO2.ClH/c1-3(5)2-4(6)7;/h3H,2,5H2,1H3,(H,6,7);1H/t3-;/m0./s1.
What are the key properties of (3S)-3-aminobutanoic acid;hydrochloride?
(3S)-3-aminobutanoic acid;hydrochloride has a molecular weight of 139.58 g/mol, XLogP of 0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-aminobutanoic acid;hydrochloride is sourced from PubChem (CID 2761505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).