sodium;hydride;(3S)-3-hydroxybutanoic acid

C4H9NaO3 — CID 173289884

IUPACsodium;hydride;(3S)-3-hydroxybutanoic acid
SMILESC[C@H](O)CC(=O)O.[H-].[Na+]
InChIInChI=1S/C4H8O3.Na.H/c1-3(5)2-4(6)7;;/h3,5H,2H2,1H3,(H,6,7);;/q;+1;-1/t3-;;/m0../s1
InChIKeySZQGTXADEMZDSK-QTNFYWBSSA-N
MW128.10 g/mol
LogP-3.04
Rot. Bonds2

About sodium;hydride;(3S)-3-hydroxybutanoic acid

sodium;hydride;(3S)-3-hydroxybutanoic acid (PubChem CID 173289884) has the molecular formula C4H9NaO3 and a molecular weight of 128.10 g/mol. Its IUPAC name is sodium;hydride;(3S)-3-hydroxybutanoic acid.

Molecular Properties

Compound Namesodium;hydride;(3S)-3-hydroxybutanoic acid
PubChem CID173289884
Molecular FormulaC4H9NaO3
Molecular Weight128.10 g/mol
Exact Mass128.04
IUPAC Namesodium;hydride;(3S)-3-hydroxybutanoic acid
SMILESC[C@H](O)CC(=O)O.[H-].[Na+]
InChIInChI=1S/C4H8O3.Na.H/c1-3(5)2-4(6)7;;/h3,5H,2H2,1H3,(H,6,7);;/q;+1;-1/t3-;;/m0../s1
InChIKeySZQGTXADEMZDSK-QTNFYWBSSA-N
XLogP-3.04
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500128.10
LogP ≤ 5-3.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze sodium;hydride;(3S)-3-hydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium;hydride;(3S)-3-hydroxybutanoic acid?
The IUPAC name of sodium;hydride;(3S)-3-hydroxybutanoic acid (CID 173289884) is sodium;hydride;(3S)-3-hydroxybutanoic acid.
What is the SMILES notation for sodium;hydride;(3S)-3-hydroxybutanoic acid?
The canonical SMILES for sodium;hydride;(3S)-3-hydroxybutanoic acid is C[C@H](O)CC(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;(3S)-3-hydroxybutanoic acid?
The InChIKey is SZQGTXADEMZDSK-QTNFYWBSSA-N. The full InChI is InChI=1S/C4H8O3.Na.H/c1-3(5)2-4(6)7;;/h3,5H,2H2,1H3,(H,6,7);;/q;+1;-1/t3-;;/m0../s1.
What are the key properties of sodium;hydride;(3S)-3-hydroxybutanoic acid?
sodium;hydride;(3S)-3-hydroxybutanoic acid has a molecular weight of 128.10 g/mol, XLogP of -3.04, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;(3S)-3-hydroxybutanoic acid is sourced from PubChem (CID 173289884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).