About butanoic acid;3-hydroxybutanoic acid
butanoic acid;3-hydroxybutanoic acid (PubChem CID 131984541) has the molecular formula C8H16O5
and a molecular weight of 192.21 g/mol. Its IUPAC name is butanoic acid;3-hydroxybutanoic acid.
Molecular Properties
| Compound Name | butanoic acid;3-hydroxybutanoic acid |
| PubChem CID | 131984541 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | butanoic acid;3-hydroxybutanoic acid |
| SMILES | CC(O)CC(=O)O.CCCC(=O)O |
| InChI | InChI=1S/C4H8O3.C4H8O2/c1-3(5)2-4(6)7;1-2-3-4(5)6/h3,5H,2H2,1H3,(H,6,7);2-3H2,1H3,(H,5,6) |
| InChIKey | XEJMYMDURBROCI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butanoic acid;3-hydroxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoic acid;3-hydroxybutanoic acid?
The IUPAC name of butanoic acid;3-hydroxybutanoic acid (CID 131984541) is butanoic acid;3-hydroxybutanoic acid.
What is the SMILES notation for butanoic acid;3-hydroxybutanoic acid?
The canonical SMILES for butanoic acid;3-hydroxybutanoic acid is CC(O)CC(=O)O.CCCC(=O)O.
What is the InChIKey of butanoic acid;3-hydroxybutanoic acid?
The InChIKey is XEJMYMDURBROCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.C4H8O2/c1-3(5)2-4(6)7;1-2-3-4(5)6/h3,5H,2H2,1H3,(H,6,7);2-3H2,1H3,(H,5,6).
What are the key properties of butanoic acid;3-hydroxybutanoic acid?
butanoic acid;3-hydroxybutanoic acid has a molecular weight of 192.21 g/mol, XLogP of 0.71, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanoic acid;3-hydroxybutanoic acid is sourced from PubChem (CID 131984541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).