C6H12O4S — CID 159132920
propane-1,2-diol;sulfanyl prop-2-enoate (PubChem CID 159132920) has the molecular formula C6H12O4S and a molecular weight of 180.22 g/mol. Its IUPAC name is propane-1,2-diol;sulfanyl prop-2-enoate.
| Compound Name | propane-1,2-diol;sulfanyl prop-2-enoate |
|---|---|
| PubChem CID | 159132920 |
| Molecular Formula | C6H12O4S |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | propane-1,2-diol;sulfanyl prop-2-enoate |
| SMILES | C=CC(=O)OS.CC(O)CO |
| InChI | InChI=1S/C3H4O2S.C3H8O2/c1-2-3(4)5-6;1-3(5)2-4/h2,6H,1H2;3-5H,2H2,1H3 |
| InChIKey | KHCUXGNHRGNMLX-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|