C13H26O5 — CID 87555404
ethoxyethane;propane-1,2-diol;prop-2-enyl prop-2-enoate (PubChem CID 87555404) has the molecular formula C13H26O5 and a molecular weight of 262.35 g/mol. Its IUPAC name is ethoxyethane;propane-1,2-diol;prop-2-enyl prop-2-enoate.
| Compound Name | ethoxyethane;propane-1,2-diol;prop-2-enyl prop-2-enoate |
|---|---|
| PubChem CID | 87555404 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | ethoxyethane;propane-1,2-diol;prop-2-enyl prop-2-enoate |
| SMILES | C=CCOC(=O)C=C.CC(O)CO.CCOCC |
| InChI | InChI=1S/C6H8O2.C4H10O.C3H8O2/c1-3-5-8-6(7)4-2;1-3-5-4-2;1-3(5)2-4/h3-4H,1-2,5H2;3-4H2,1-2H3;3-5H,2H2,1H3 |
| InChIKey | JTAGUKKGTKQYLF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|