About ethoxyethane;1-hydroxypropyl prop-2-enoate
ethoxyethane;1-hydroxypropyl prop-2-enoate (PubChem CID 174930262) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is ethoxyethane;1-hydroxypropyl prop-2-enoate.
Molecular Properties
| Compound Name | ethoxyethane;1-hydroxypropyl prop-2-enoate |
| PubChem CID | 174930262 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | ethoxyethane;1-hydroxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OC(O)CC.CCOCC |
| InChI | InChI=1S/C6H10O3.C4H10O/c1-3-5(7)9-6(8)4-2;1-3-5-4-2/h3,6,8H,1,4H2,2H3;3-4H2,1-2H3 |
| InChIKey | MYVGXCBHRIISNY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;1-hydroxypropyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;1-hydroxypropyl prop-2-enoate?
The IUPAC name of ethoxyethane;1-hydroxypropyl prop-2-enoate (CID 174930262) is ethoxyethane;1-hydroxypropyl prop-2-enoate.
What is the SMILES notation for ethoxyethane;1-hydroxypropyl prop-2-enoate?
The canonical SMILES for ethoxyethane;1-hydroxypropyl prop-2-enoate is C=CC(=O)OC(O)CC.CCOCC.
What is the InChIKey of ethoxyethane;1-hydroxypropyl prop-2-enoate?
The InChIKey is MYVGXCBHRIISNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C4H10O/c1-3-5(7)9-6(8)4-2;1-3-5-4-2/h3,6,8H,1,4H2,2H3;3-4H2,1-2H3.
What are the key properties of ethoxyethane;1-hydroxypropyl prop-2-enoate?
ethoxyethane;1-hydroxypropyl prop-2-enoate has a molecular weight of 204.27 g/mol, XLogP of 1.49, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;1-hydroxypropyl prop-2-enoate is sourced from PubChem (CID 174930262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).