1-hydroxypropyl carbamate;prop-2-enoic acid

C7H13NO5 — CID 87449677

IUPAC1-hydroxypropyl carbamate;prop-2-enoic acid
SMILESC=CC(=O)O.CCC(O)OC(N)=O
InChIInChI=1S/C4H9NO3.C3H4O2/c1-2-3(6)8-4(5)7;1-2-3(4)5/h3,6H,2H2,1H3,(H2,5,7);2H,1H2,(H,4,5)
InChIKeyZZJBPTYWDGDHDQ-UHFFFAOYSA-N
MW191.18 g/mol
LogP0.07
Rot. Bonds3

About 1-hydroxypropyl carbamate;prop-2-enoic acid

1-hydroxypropyl carbamate;prop-2-enoic acid (PubChem CID 87449677) has the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. Its IUPAC name is 1-hydroxypropyl carbamate;prop-2-enoic acid.

Molecular Properties

Compound Name1-hydroxypropyl carbamate;prop-2-enoic acid
PubChem CID87449677
Molecular FormulaC7H13NO5
Molecular Weight191.18 g/mol
Exact Mass191.08
IUPAC Name1-hydroxypropyl carbamate;prop-2-enoic acid
SMILESC=CC(=O)O.CCC(O)OC(N)=O
InChIInChI=1S/C4H9NO3.C3H4O2/c1-2-3(6)8-4(5)7;1-2-3(4)5/h3,6H,2H2,1H3,(H2,5,7);2H,1H2,(H,4,5)
InChIKeyZZJBPTYWDGDHDQ-UHFFFAOYSA-N
XLogP0.07
TPSA109.85 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.18
LogP ≤ 50.07
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 1-hydroxypropyl carbamate;prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-hydroxypropyl carbamate;prop-2-enoic acid?
The IUPAC name of 1-hydroxypropyl carbamate;prop-2-enoic acid (CID 87449677) is 1-hydroxypropyl carbamate;prop-2-enoic acid.
What is the SMILES notation for 1-hydroxypropyl carbamate;prop-2-enoic acid?
The canonical SMILES for 1-hydroxypropyl carbamate;prop-2-enoic acid is C=CC(=O)O.CCC(O)OC(N)=O.
What is the InChIKey of 1-hydroxypropyl carbamate;prop-2-enoic acid?
The InChIKey is ZZJBPTYWDGDHDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3.C3H4O2/c1-2-3(6)8-4(5)7;1-2-3(4)5/h3,6H,2H2,1H3,(H2,5,7);2H,1H2,(H,4,5).
What are the key properties of 1-hydroxypropyl carbamate;prop-2-enoic acid?
1-hydroxypropyl carbamate;prop-2-enoic acid has a molecular weight of 191.18 g/mol, XLogP of 0.07, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropyl carbamate;prop-2-enoic acid is sourced from PubChem (CID 87449677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).