C14H30O6Si — CID 174844646
ethoxyethane;1-trimethoxysilylbutyl prop-2-enoate (PubChem CID 174844646) has the molecular formula C14H30O6Si and a molecular weight of 322.47 g/mol. Its IUPAC name is ethoxyethane;1-trimethoxysilylbutyl prop-2-enoate.
| Compound Name | ethoxyethane;1-trimethoxysilylbutyl prop-2-enoate |
|---|---|
| PubChem CID | 174844646 |
| Molecular Formula | C14H30O6Si |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | ethoxyethane;1-trimethoxysilylbutyl prop-2-enoate |
| SMILES | C=CC(=O)OC(CCC)[Si](OC)(OC)OC.CCOCC |
| InChI | InChI=1S/C10H20O5Si.C4H10O/c1-6-8-10(15-9(11)7-2)16(12-3,13-4)14-5;1-3-5-4-2/h7,10H,2,6,8H2,1,3-5H3;3-4H2,1-2H3 |
| InChIKey | IDDOIUWMMXSOJJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|