About 1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol
1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol (PubChem CID 88525550) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol.
Molecular Properties
| Compound Name | 1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol |
| PubChem CID | 88525550 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol |
| SMILES | C=CC(=O)OC(O)CCC.C=CCO |
| InChI | InChI=1S/C7H12O3.C3H6O/c1-3-5-7(9)10-6(8)4-2;1-2-3-4/h4,7,9H,2-3,5H2,1H3;2,4H,1,3H2 |
| InChIKey | ZJDVFVLTLGRGHV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol?
The IUPAC name of 1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol (CID 88525550) is 1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol.
What is the SMILES notation for 1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol?
The canonical SMILES for 1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol is C=CC(=O)OC(O)CCC.C=CCO.
What is the InChIKey of 1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol?
The InChIKey is ZJDVFVLTLGRGHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.C3H6O/c1-3-5-7(9)10-6(8)4-2;1-2-3-4/h4,7,9H,2-3,5H2,1H3;2,4H,1,3H2.
What are the key properties of 1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol?
1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol has a molecular weight of 202.25 g/mol, XLogP of 1.00, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxybutyl prop-2-enoate;prop-2-en-1-ol is sourced from PubChem (CID 88525550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).