C16H38O5Si4 — CID 141421352
1-[[ethoxy(dimethyl)silyl]-bis[methoxy(dimethyl)silyl]silyl]propyl prop-2-enoate (PubChem CID 141421352) has the molecular formula C16H38O5Si4 and a molecular weight of 422.82 g/mol. Its IUPAC name is 1-[[ethoxy(dimethyl)silyl]-bis[methoxy(dimethyl)silyl]silyl]propyl prop-2-enoate.
| Compound Name | 1-[[ethoxy(dimethyl)silyl]-bis[methoxy(dimethyl)silyl]silyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 141421352 |
| Molecular Formula | C16H38O5Si4 |
| Molecular Weight | 422.82 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-[[ethoxy(dimethyl)silyl]-bis[methoxy(dimethyl)silyl]silyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OC(CC)[Si]([Si](C)(C)OC)([Si](C)(C)OC)[Si](C)(C)OCC |
| InChI | InChI=1S/C16H38O5Si4/c1-12-15(17)21-16(13-2)25(22(6,7)18-4,23(8,9)19-5)24(10,11)20-14-3/h12,16H,1,13-14H2,2-11H3 |
| InChIKey | AMCFDZULLKUFLL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.82 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|