About [ethoxy(methoxy)methyl] prop-2-enoate
[ethoxy(methoxy)methyl] prop-2-enoate (PubChem CID 87919387) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is [ethoxy(methoxy)methyl] prop-2-enoate.
Molecular Properties
| Compound Name | [ethoxy(methoxy)methyl] prop-2-enoate |
| PubChem CID | 87919387 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | [ethoxy(methoxy)methyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(OC)OCC |
| InChI | InChI=1S/C7H12O4/c1-4-6(8)11-7(9-3)10-5-2/h4,7H,1,5H2,2-3H3 |
| InChIKey | LYGMPQSPGWCRPQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [ethoxy(methoxy)methyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethoxy(methoxy)methyl] prop-2-enoate?
The IUPAC name of [ethoxy(methoxy)methyl] prop-2-enoate (CID 87919387) is [ethoxy(methoxy)methyl] prop-2-enoate.
What is the SMILES notation for [ethoxy(methoxy)methyl] prop-2-enoate?
The canonical SMILES for [ethoxy(methoxy)methyl] prop-2-enoate is C=CC(=O)OC(OC)OCC.
What is the InChIKey of [ethoxy(methoxy)methyl] prop-2-enoate?
The InChIKey is LYGMPQSPGWCRPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-4-6(8)11-7(9-3)10-5-2/h4,7H,1,5H2,2-3H3.
What are the key properties of [ethoxy(methoxy)methyl] prop-2-enoate?
[ethoxy(methoxy)methyl] prop-2-enoate has a molecular weight of 160.17 g/mol, XLogP of 0.68, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [ethoxy(methoxy)methyl] prop-2-enoate is sourced from PubChem (CID 87919387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).