About 1-(dimethylamino)propyl prop-2-enoate;hydrofluoride
1-(dimethylamino)propyl prop-2-enoate;hydrofluoride (PubChem CID 173036316) has the molecular formula C8H16FNO2
and a molecular weight of 177.22 g/mol. Its IUPAC name is 1-(dimethylamino)propyl prop-2-enoate;hydrofluoride.
Molecular Properties
| Compound Name | 1-(dimethylamino)propyl prop-2-enoate;hydrofluoride |
| PubChem CID | 173036316 |
| Molecular Formula | C8H16FNO2 |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 1-(dimethylamino)propyl prop-2-enoate;hydrofluoride |
| SMILES | C=CC(=O)OC(CC)N(C)C.F |
| InChI | InChI=1S/C8H15NO2.FH/c1-5-7(9(3)4)11-8(10)6-2;/h6-7H,2,5H2,1,3-4H3;1H |
| InChIKey | IOMWQNGVZCXGQU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)propyl prop-2-enoate;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)propyl prop-2-enoate;hydrofluoride?
The IUPAC name of 1-(dimethylamino)propyl prop-2-enoate;hydrofluoride (CID 173036316) is 1-(dimethylamino)propyl prop-2-enoate;hydrofluoride.
What is the SMILES notation for 1-(dimethylamino)propyl prop-2-enoate;hydrofluoride?
The canonical SMILES for 1-(dimethylamino)propyl prop-2-enoate;hydrofluoride is C=CC(=O)OC(CC)N(C)C.F.
What is the InChIKey of 1-(dimethylamino)propyl prop-2-enoate;hydrofluoride?
The InChIKey is IOMWQNGVZCXGQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.FH/c1-5-7(9(3)4)11-8(10)6-2;/h6-7H,2,5H2,1,3-4H3;1H.
What are the key properties of 1-(dimethylamino)propyl prop-2-enoate;hydrofluoride?
1-(dimethylamino)propyl prop-2-enoate;hydrofluoride has a molecular weight of 177.22 g/mol, XLogP of 1.17, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)propyl prop-2-enoate;hydrofluoride is sourced from PubChem (CID 173036316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).