C10H17O9PSi — CID 178069792
1-[ethoxy-methoxy-[(1-oxo-2,4,5-trioxa-1λ5-phosphabicyclo[1.1.1]pentan-3-yl)oxy]silyl]propyl prop-2-enoate (PubChem CID 178069792) has the molecular formula C10H17O9PSi and a molecular weight of 340.30 g/mol. Its IUPAC name is 1-[ethoxy-methoxy-[(1-oxo-2,4,5-trioxa-1λ5-phosphabicyclo[1.1.1]pentan-3-yl)oxy]silyl]propyl prop-2-enoate.
| Compound Name | 1-[ethoxy-methoxy-[(1-oxo-2,4,5-trioxa-1λ5-phosphabicyclo[1.1.1]pentan-3-yl)oxy]silyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 178069792 |
| Molecular Formula | C10H17O9PSi |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 1-[ethoxy-methoxy-[(1-oxo-2,4,5-trioxa-1λ5-phosphabicyclo[1.1.1]pentan-3-yl)oxy]silyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OC(CC)[Si](OC)(OCC)OC12OP(=O)(O1)O2 |
| InChI | InChI=1S/C10H17O9PSi/c1-5-8(11)15-9(6-2)21(13-4,14-7-3)19-10-16-20(12,17-10)18-10/h5,9H,1,6-7H2,2-4H3 |
| InChIKey | MHSDHVNBIOZVNK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|