About (amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate
(amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate (PubChem CID 174833655) has the molecular formula C11H27NO5Si2
and a molecular weight of 309.51 g/mol. Its IUPAC name is (amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate.
Molecular Properties
| Compound Name | (amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate |
| PubChem CID | 174833655 |
| Molecular Formula | C11H27NO5Si2 |
| Molecular Weight | 309.51 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(CC)C(C)O[SiH3].CO[Si](C)(N)OC |
| InChI | InChI=1S/C8H16O3Si.C3H11NO2Si/c1-4-7(6(3)11-12)10-8(9)5-2;1-5-7(3,4)6-2/h5-7H,2,4H2,1,3,12H3;4H2,1-3H3 |
| InChIKey | JQNHXTRNGKTVTF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.51 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate?
The IUPAC name of (amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate (CID 174833655) is (amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate.
What is the SMILES notation for (amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate?
The canonical SMILES for (amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate is C=CC(=O)OC(CC)C(C)O[SiH3].CO[Si](C)(N)OC.
What is the InChIKey of (amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate?
The InChIKey is JQNHXTRNGKTVTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3Si.C3H11NO2Si/c1-4-7(6(3)11-12)10-8(9)5-2;1-5-7(3,4)6-2/h5-7H,2,4H2,1,3,12H3;4H2,1-3H3.
What are the key properties of (amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate?
(amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate has a molecular weight of 309.51 g/mol, XLogP of -0.01, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (amino-methoxy-methylsilyl)oxymethane;2-silyloxypentan-3-yl prop-2-enoate is sourced from PubChem (CID 174833655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).